Isoaesculioside D
Isoaesculioside D, a naturally-occurring compound, possesses exciting anti-inflammatory and anti-cancer properties, offering potential therapeutic applications in the treatment of cancer and inflammatory conditions. This compound, through its ability to inhibit the growth of selected cancer cells and decrease inflammation in animal models, has demonstrated its immense value in the pharmaceutical industry. Its bioactive nature warrants further investigation into its potential for curing cancers and alleviating inflammation in humans.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7121 |
| Pricing | Inquire |
| Cas | 1184581-59-6 |
| Molecular Weight | 1171.33 |
| Molecular Formula | C58H90O24 |
| Canonical SMILES | O=C(O)C1OC(OC2CCC3(C)C(CCC4(C)C3CC=C5C6CC(C)(C)C(OC(=O)C(=CC)C)C(OC(=O)C(=CC)C)C6(CO)C(O)CC54C)C2(C)CO)C(OC7OC(CO)C(O)C(O)C7O)C(O)C1OC8OC(CO)C(O)C(O)C8O |