1-O-Acetyl-2,3,5-tri-O-benzoyl-4-thio-b-D-ribofuranose
1-O-Acetyl-2,3,5-tri-O-benzoyl-4-thio-b-D-ribofuranose, an essential biochemical, serves as a vital intermediary in synthesizing nucleotides and nucleosides such as antiviral and anticancer drugs, like AZT and FdUrd. Moreover, it acts as a crucial reagent in the creation of modified RNA and DNA oligonucleotides, which enable the possible cure of genetic and metabolic disorders, thereby demonstrating its therapeutic potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1015447-26-3 |
| Pricing | Inquire |
| Cas | 1015447-26-3 |
| Molecular Weight | 520.55 |
| Molecular Formula | C28H24O8S |
| Canonical SMILES | CC(=O)OC1C(C(C(S1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |