ALLO-1
ALLO-1 is a SMO antagonist that inhibits both wild-type (IC50 = 50 nM) and mutant SMO, including the D473H SMO mutant (IC50s = 300-1000 nM). ALLO-1 is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif. This compound binds to the SMO cysteine-rich domain, which is a different mechanism of interaction compared to other known SMO ligands that bind the transmembrane pocket.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37468-32-9 |
| Pricing | Inquire |
| Cas | 37468-32-9 |
| Molecular Weight | 314.8 |
| Molecular Formula | C17H15ClN2O2 |
| Canonical SMILES | O=C1N(C2=CC=C(Cl)C=C2)C(N(CC3=CC=CC=C3)C1C)=O |