Biotin-C4-amide-C5-NH2
Biotin-C4-amide-C5-NH2 is a highly regarded compound in the biomedical field and is of vital importance due to its multifaceted role in therapeutic intervention. It facilitates the development of drugs to combat a variety of diseases, including but not limited to cancer, diabetes, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01515 |
| Pricing | Inquire |
| Cas | 151294-96-1 |
| Molecular Weight | 314.45 |
| Molecular Formula | C14H26N4O2S |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NCCCCN)NC(=O)N2 |