((1R,2R)-2-((4-(Benzo[d]isothiazol-3-yl)piperazin-1-yl)methyl)cyclohexyl)methanamine
((1R,2R)-2-((4-(Benzo[d]isothiazol-3-yl)piperazin-1-yl)methyl)cyclohexyl)methanamine, commonly known as BDMC, a highly intricate and remarkable compound widely employed in the biomedical field. It thrives as a pivotal agent in studying diverse neurological disorders that beset humanity. Its mode of action entails adroitly targeting specific receptors situated within the central nervous system, aiding in studying afflictions like schizophrenia and bipolar disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1260138-03-1 |
| Pricing | Inquire |
| Cas | 1260138-03-1 |
| Molecular Weight | 344.53 |
| Molecular Formula | C19H28N4S |
| Canonical SMILES | C1CCC(C(C1)CN)CN2CCN(CC2)C3=NSC4=CC=CC=C43 |