2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide
2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide, a remarkable adenosine analog extensively utilized in the field of biomedicine, holds substantial potential for diverse biomedical applications. Its efficacy spans the treatment of select malignancies and viral ailments. Furthermore, this compound manifests intriguing anti-inflammatory characteristics, rendering it an extremely valuable entity in investigative enzymatic research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39491-51-5 |
| Pricing | Inquire |
| Cas | 39491-51-5 |
| Molecular Weight | 334.33 |
| Molecular Formula | C14H18N6O4 |
| Canonical SMILES | CC1(OC2C(O1)C(OC2C(=O)NC)N3C=NC4=C(N=CN=C43)N)C |