Benzyl 6-Hydroxyhexanoate
Benzyl 6-hydroxyhexanoate is an intermediate in the synthesis of N-5-Carboxypentyl-1-deoxynojirimycin (C181200), which is a ligand used for the preparation of an affinity resin highly specific for glucosidase I purification. Glucosidase I is involved in the post-translational processing of N-linked glycoproteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB073673 |
| Pricing | Inquire |
| Cas | 125878-06-0 |
| Molecular Weight | 222.28 |
| Molecular Formula | C13H18O3 |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)CCCCCO |