2'-C-Methyl-2-thiouridine
2'-C-Methyl-2-thiouridine, a modified nucleoside, exhibits antiviral properties and is utilized in the treatment of specific viral infections that include hepatitis C, HIV, and Zika virus. Additionally, investigations are underway for employing this compound in cancer therapy due to its promising outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1678507-60-2 |
| Pricing | Inquire |
| Cas | 1678507-60-2 |
| Molecular Weight | 274.29 |
| Molecular Formula | C10H14N2O5S |
| Canonical SMILES | CC1(C(C(OC1N2C=CC(=O)NC2=S)CO)O)O |