Glysperin C
It is produced by the strain of Bacillus cereus Nos. F173-B61 and F262-B54. It has anti-gram positive bacteria and negative bacteria (including aminoglycoside antibiotic resistant bacteria) activity, the antibacterial activity of main component Glysperin A is 2-4 times stronger than B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01273 |
| Pricing | Inquire |
| Cas | 78213-54-4 |
| Molecular Weight | 1008.12 |
| Molecular Formula | C44H77N7O19 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3O)OC4C(OC(C4O)OC5=CC=C(C=C5)C(=O)NCCCNCCCCNCCCCN)CO)CO)O)CO)NC(=O)C(C)N)O)N |