2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate
2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate, a highly significant compound extensively employed in the biomedicine sector, serves as a multifaceted reagent within the oligosaccharide synthesis domain. Its primary purpose lies in glycosylating diverse pharmaceuticals and biomolecules. This invaluable product expedites the advancement of pioneering therapeutic interventions, contributing to the precise management of afflictions encompassing cancer, autoimmune disorders, as well as viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 92052-29-4 |
| Pricing | Inquire |
| Cas | 92052-29-4 |
| Molecular Weight | 492.69 |
| Molecular Formula | C16H20Cl3NO10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |