Lonchocarpol A
6,8-Diprenylnaringenin is a hop prenylflavonoid that is a breast cancer resistance protein (BCRP/ABCG2) inhibitor. It inhibits ABCG2 mediated efflux of mitoxantrone and 3H-methotrexate transport (IC50 = 0.41 μM). 6,8-Diprenylnaringenin has some estrogenic activity, but its potency is less than 1% of 8-pentenyl naringin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68236-11-3 |
| Pricing | Inquire |
| Cas | 68236-11-3 |
| Molecular Weight | 408.49 |
| Molecular Formula | C25H28O5 |
| Canonical SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)CC(O2)C3=CC=C(C=C3)O)CC=C(C)C)O)C |