Allo-3a-tetrahydro cortisol 3-O-b-D-glucuronide
Allo-3a-tetrahydro cortisol 3-O-b-D-glucuronide is a highly intricate and sophisticated compound that is widely employed in the in-depth investigations pertaining to the metabolism . Its paramount significance lies in its pivotal role in the exploration of adrenal function and the precise quantification of cortisol.
| Supplier | BOC Sciences |
|---|---|
| Product # | 30954-21-3 |
| Pricing | Inquire |
| Cas | 30954-21-3 |
| Molecular Weight | 542.62 |
| Molecular Formula | C27H42O11 |
| Canonical SMILES | CC12CCC(CC1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O)OC5C(C(C(C(O5)C(=O)O)O)O)O |