5'-O-Benzoyl-2'-deoxy-N2-isobutyrylguanosine
5'-O-Benzoyl-2'-deoxy-N2-isobutyrylguanosine, a remarkable compound prevalent in the biomedical industry, holds profound potential in combatting numerous diseases. Currently under intense scrutiny, this compound exhibits unprecedented antiviral prowess, specifically against RNA viruses. Its exceptional capability to impede the replication of destitute viruses positions it exceptionally well as a conceivable frontrunner for the innovation of groundbreaking antiviral therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 173271-18-6 |
| Pricing | Inquire |
| Cas | 173271-18-6 |
| Molecular Weight | 441.45 |
| Molecular Formula | C21H23N5O6 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(=O)C4=CC=CC=C4)O |