3-O-(N-Acetyl-α-Neuraminosyl)-D-Galactose
3-O-(N-Acetyl-α-Neuraminosyl)-D-Galactose, a carbohydrate molecule utilized in the biomedicine industry to investigate neurodegenerative ailments, specifically Alzheimer's disease, as well as cancer and inflammation. Its elemental role in modulating cell surface interactions and signal transduction events may have therapeutic implications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83563-61-5 |
| Pricing | Inquire |
| Cas | 83563-61-5 |
| Molecular Weight | 471.41 |
| Molecular Formula | C17H29NO14 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)OC(C(C=O)O)C(C(CO)O)O)O |