2,6-Dichloro-4-(trifluoromethyl)nicotinonitrile
2,6-Dichloro-4-(trifluoromethyl)nicotinonitrile (CAS# 13600-42-5) is used as a reagent in the synthesis of cyano(trifluoromethyl)aminopyridine derivatives which are used as androgen receptor antagonists for stimulating hair growth and reducing sebum production. 3-Cyano-2,6-dichloro-4-trifluoromethylpyridine is also used in the preparation of novel analogs of marine indole alkaloids which are used as potential anticancer agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB008267 |
| Pricing | Inquire |
| Cas | 13600-42-5 |
| Molecular Weight | 241.00 |
| Molecular Formula | C7HCl2F3N2 |
| Canonical SMILES | C1=C(C(=C(N=C1Cl)Cl)C#N)C(F)(F)F |