Alkyne maleimide
Alkyne maleimide is a bifunctional linker reagent which allows to attach terminal alkyne to various thiol-containing molecules, such as proteins containing cysteine residues. The alkyne moiety can be then conjugated with various azides via copper-catalyzed Click chemistry reaction.
Supplier | BOC Sciences |
---|---|
Product # | R02-0006 |
Pricing | Inquire |
Molecular Weight | 234.25 |
Molecular Formula | C12H14N2O3 |
Canonical SMILES | C#CCCCC(=O)NCCN1C(=O)C=CC1=O |