10-O-Methylprotosappanin B
10-O-Methylprotosappanin B is a natural compound found in Sappan wood, traditionally used in herbal medicine. With its anti-inflammatory properties, it has shown promising potential in the research of various diseases such as cancer is arthritis and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5355 |
| Pricing | Inquire |
| Cas | 111830-77-4 |
| Molecular Weight | 318.321 |
| Molecular Formula | C17H18O6 |
| Canonical SMILES | COC1=C(C=C2C(=C1)CC(COC3=C2C=CC(=C3)O)(CO)O)O |