4-Aminophenyl b-D-thiomannopyranoside
4-Aminophenyl b-D-thiomannopyranoside is a valuable tool compound used in biomedicine. It acts as a substrate analogue for Glucosidase enzymes and can be utilized in drug development and enzyme inhibition studies. This compound plays a crucial role in understanding the mechanism of action and designing therapeutic strategies for diseases related to aberrant enzyme activity like lysosomal storage disorders and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129970-93-0 |
| Pricing | Inquire |
| Cas | 129970-93-0 |
| Molecular Weight | 287.33 |
| Molecular Formula | C12H17NO5S |
| Canonical SMILES | C1=CC(=CC=C1N)SC2C(C(C(C(O2)CO)O)O)O |