Paeciloquinone A
It is produced by the strain of Paecilomyces carneus P-177. It can inhibit the epidermal growth factor receptor protein tyrosine kinase. Paeciloquinone A inhibits the V-abl protein tyrosine kinase with IC50 of 0.59 μmol/L.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02340 |
| Pricing | Inquire |
| Cas | 162797-33-3 |
| Molecular Weight | 356.28 |
| Molecular Formula | C18H12O8 |
| Canonical SMILES | C1COC(=O)C1C2=C(C=C3C(=C2O)C(=O)C4=C(C3=O)C=C(C=C4O)O)O |