Scytalol D
It is produced by the strain of Scytalidium sp. 36-93. It selectively inhibits biosynthesis of dihydroxynaphthalene melanin in Lachnellula sp. A32-89, but does not inhibit the growth of the strain.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02894 |
| Pricing | Inquire |
| Cas | 208183-24-8 |
| Molecular Weight | 264.27 |
| Molecular Formula | C14H16O5 |
| Canonical SMILES | CC(=O)CC1CC(=O)C2=C(C1O)C=C(C=C2O)OC |