Cafestol
Cafestol is a natural bioactive substance isolated from the unsaponifiable fraction of petroleum ether extract of coffee beans, it acts as a GST (glutathione S-transferase) inducer and exhibits chemoprotective activity. Dietary cafestol does increase total cholesterol and triglycerides in ApoE3Leiden mice, an effect which is associated with selective activation of farnesoid X receptors and pregnane X receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 469-83-0 |
| Pricing | Inquire |
| Cas | 469-83-0 |
| Molecular Weight | 316.4 |
| Molecular Formula | C20H28O3 |
| Canonical SMILES | O[C@]([C@]1([H])CC2)(CO)C[C@](CC[C@@]34[H])(C1)[C@]2([H])[C@]3(C)CCC5=C4C=CO5 |