5-Bromo-4-chloro-3-indolyl sulfate potassium salt
5-Bromo-4-chloro-3-indolyl sulfate potassium salt is a vital reagent used in biomedical research. It is commonly used as a substrate to detect β-galactosidase activity in drug discovery and the study of gene expression. Its ability to produce a blue precipitate allows for visual identification of enzymatic activity, aiding in the treatment of various diseases including cancer and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6578-07-0 |
| Pricing | Inquire |
| Cas | 6578-07-0 |
| Molecular Weight | 364.64 |
| Molecular Formula | C8H4BrClKNO4S |
| Canonical SMILES | C1=CC(=C(C2=C1NC=C2OS(=O)(=O)[O-])Cl)Br.[K+] |