Tacrolimus EP Impurity F
Tacrolimus EP Impurity F is an impurity of Tacrolimus, which is a calcineurin inhibitor used as an immunosuppressant after organ transplantation to reduce the activity of the patient's immune system, thereby reducing the risk of organ rejection.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1393890-33-9 |
| Pricing | Inquire |
| Cas | 1393890-33-9 |
| Molecular Weight | 804.02 |
| Molecular Formula | C44H69NO12 |
| Canonical SMILES | CC1CC(C(C(CC(C(=O)C(=O)C(=O)N2CCCCC2C(=O)OC(C(C(CC(=O)C(C=C(C1)C)CC=C)O)C)C(=CC3CCC(C(C3)OC)O)C)C)OC)O)OC |