2,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin
2,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin, a compound widely employed in the biomedical field, plays a pivotal role in enhancing drug efficacy through its distinct structural properties. This versatile agent facilitates the solubilization and regulated release of drugs afflicted with poor solubility or instability. Its profound implications extend to formulating treatments for ailments including but not limited to cancer, cardiovascular disorders, and neurodegenerative maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123155-04-4 |
| Pricing | Inquire |
| Cas | 123155-04-4 |
| Molecular Weight | 2131.18 |
| Molecular Formula | C98H196O35Si7 |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C2C(C(C(O1)OC3C(OC(C(C3OC)OC)OC4C(OC(C(C4OC)OC)OC5C(OC(C(C5OC)OC)OC6C(OC(C(C6OC)OC)OC7C(OC(C(C7OC)OC)OC8C(OC(O2)C(C8OC)OC)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)OC)OC |