Progesterone EP Impurity K
An impurities of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
Supplier | BOC Sciences |
---|---|
Product # | 17652-16-3 |
Pricing | Inquire |
Cas | 17652-16-3 |
Molecular Weight | 312.46 |
Molecular Formula | C21H28O2 |
Canonical SMILES | CC(=O)C1CCC2C1(CC=C3C2CCC4=CC(=O)CCC43C)C |