Madecassic acid
Madecassic acid is a natural triterpenoid found in the herbs of Centella asiatica (L.) Urban. Madecassic acid has strong metabolic capacity. Madecassic acid is used as a wound-healing, anti-inflammatory and anti-cancer agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6277 |
| Pricing | Inquire |
| Cas | 18449-41-7 |
| Molecular Weight | 504.70 |
| Molecular Formula | C30H48O6 |
| Canonical SMILES | O=C(O)C12CCC(C)C(C)C2C3=CCC4C5(C)CC(O)C(O)C(C)(CO)C5C(O)CC4(C)C3(C)CC1 |