(R)-Bupivacaine
(R)-Bupivacaine HCl is a potent local anesthetic used in the biomedical industry. It is employed to target specific sodium channels in studying chronic pain, postherpetic neuralgia and various other painful conditions. Its high affinity and prolonged duration make it a valuable tool in pain research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27262-45-9 |
| Pricing | Inquire |
| Cas | 27262-45-9 |
| Molecular Weight | 288.43 |
| Molecular Formula | C18H28N2O |
| Canonical SMILES | CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C |