Formycin B
Formycin B is a nucleoside antibiotic, showcasing a formidable competence in thwarting the progression of RNA synthesis in bacterial cellular entities through its assidious targeting of RNA polymerases. It finds inhibitory efficacy against select viral strains, including influenza and herpes virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13877-76-4 |
| Pricing | Inquire |
| Cas | 13877-76-4 |
| Molecular Weight | 268.23 |
| Molecular Formula | C10H12N4O5 |
| Canonical SMILES | C1=NC2=C(NN=C2C(=O)N1)C3C(C(C(O3)CO)O)O |