5'-O-(Dimethoxytrityl)-O6-phenyl-2'-deoxyinosine
5'-O-(Dimethoxytrityl)-O6-phenyl-2'-deoxyinosine is a paramount compound employed in the field of compound for the exploration of pharmaceutical entities. Its intricate molecular configuration renders it an indispensable protagonist in the pharmaceutical continuum, with a proficiency to target distinct cellular conduits responsible for the manifestation of ailments encompassing neoplastic maladies, viral pathogens and hereditary anomalies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 133471-08-6 |
| Pricing | Inquire |
| Cas | 133471-08-6 |
| Molecular Weight | 630.71 |
| Molecular Formula | C37H34N4O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=NC6=C5N=CN=C6OC7=CC=CC=C7)O |