4'-C-Fluoroadenosine
4'-C-Fluoroadenosine, a prominent pharmaceutical compound with immense potential in the biomedical sector, functions as a remarkable treatment strategy against a multitude of diseases. Its paramount role lies in impeding DNA synthesis, hence showcasing a significant anti-tumor effect, particularly in cancer therapy. Demonstrating extraordinary progress, 4'-C-Fluoroadenosine has also exhibited promising outcomes concerning the management of viral infections, notably hepatitis C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 170874-47-2 |
| Pricing | Inquire |
| Cas | 170874-47-2 |
| Molecular Weight | 285.23 |
| Molecular Formula | C10H12FN5O4 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)(CO)F)O)O)N |