N6-Benzyl-2'-C-methyladenosine
N6-Benzyl-2'-C-methyladenosine is a valuable compound used in the biomedical industry. This product is involved in the development of potential drugs targeting various diseases including cancer, neurological disorders, and viral infections. It exhibits promising therapeutic effects due to its ability to modulate cellular functions and pathways associated with these conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 849241-79-8 |
| Pricing | Inquire |
| Cas | 849241-79-8 |
| Molecular Weight | 371.39 |
| Molecular Formula | C18H21N5O4 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C(N=CN=C32)NCC4=CC=CC=C4)CO)O)O |