5-Hydroxyomeprazole sulphide
5-Hydroxyomeprazole sulphide is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103876-99-9 |
| Pricing | Inquire |
| Cas | 103876-99-9 |
| Molecular Weight | 345.42 |
| Molecular Formula | C17H19N3O3S |
| Canonical SMILES | CC1=C(C(=CN=C1CSC2=NC3=C(N2)C=C(C=C3)OC)CO)OC |