3'-O-Amino-2'-deoxycytidine 5'-triphosphate
3'-O-Amino-2'-deoxycytidine 5'-triphosphate, an essential molecule in the realm of DNA investigation and biomedical studies, assumes the position of a paramount reagent. Within enzymatic polymerization processes, this valuable substrate readily partakes, thus facilitating DNA molecule synthesis. By engaging with the mechanisms underpinning DNA replication and repair, this product assumes an indispensable role. Moreover, its utilization extends to probing diseases elucidated by DNA mutations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1220515-75-2 |
| Pricing | Inquire |
| Cas | 1220515-75-2 |
| Molecular Weight | 482.17 |
| Molecular Formula | C9H17N4O13P3 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)ON |