D-Cellobial
D-Cellobial is an exquisite and groundbreaking compound profoundly employed for the research of assorted maladies, encompassing the intricate realms of cancer and diabetes. This prodigious asset acts as an unparalleled inhibitor, thwarting the nefarious activity of meticulously targeted enzymes intricately intertwined within the metabolic cascades.
| Supplier | BOC Sciences |
|---|---|
| Product # | 490-51-7 |
| Pricing | Inquire |
| Cas | 490-51-7 |
| Molecular Weight | 308.28 |
| Molecular Formula | C12H20O9 |
| Canonical SMILES | C1=COC(C(C1O)OC2C(C(C(C(O2)CO)O)O)O)CO |