Chloropolysporin C
Chloropolysporin C is produced by the strain of Faenia interjecta SANK 60983. It has strong activity of anti-gram-positive bacteria, including clinically isolated methicillin-resistant Staphylococcus aureus (MRSA) and enterococcus bacteria. C has a strong synergistic effect with β-lactam antibiotics.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00318 |
| Pricing | Inquire |
| Cas | 105650-12-2 |
| Molecular Weight | 1702.84 |
| Molecular Formula | C77H79Cl3N8O30 |
| Canonical SMILES | CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)C(C(=O)N3)NC(=O)C6C7=CC(=C(C(=C7)OC8=C(C=C(C=C8)C(C(C(=O)NC(C(=O)N6)C9=CC(=C(C=C9)O)Cl)NC(=O)C(C1=CC=C(C=C1)O)NC)OC1C(C(C(C(O1)CO)O)O)O)Cl)OC1C(C(C(C(O1)CO)O)O)O)OC1=C(C=C2C=C1)Cl)O)C(=O)O)N)O |