N4-Benzoyl-2'-O-(2-methoxyethyl)-5-methylcytidine
N4-Benzoyl-2'-O-(2-methoxyethyl)-5-methylcytidine, an extraordinary compound utilized in the biomedical sector, showcases robust antiviral properties. Its efficacy is notably significant against RNA viruses such as respiratory syncytial virus (RSV) and coronaviruses. By selectively inhibiting viral replication through the precise targeting of viral RNA polymerases, it presents itself as a compelling contender for the advancement of groundbreaking antiviral therapeutics. With its multifaceted mechanisms of action, this compound holds immense promise in the realm of cutting-edge antiviral research and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 340162-93-8 |
| Pricing | Inquire |
| Cas | 340162-93-8 |
| Molecular Weight | 419.43 |
| Molecular Formula | C20H25N3O7 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)CO)O)OCCOC |