DMTr-2'-ara-OAc-U-3'-CE-Phosphoramidite
DMTr-2'-ara-OAc-U-3'-CE-Phosphoramidite is utilized in oligonucleotide synthesis. It is employed to introduce modified uridine residues with altered chemical properties into nucleic acid sequences, suitable for applications such as RNA interference (RNAi), gene silencing, and nucleic acid therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00589 |
| Pricing | Inquire |
| Cas | 173099-63-3 |
| Molecular Weight | 788.83 |
| Molecular Formula | C41H49N4O10P |
| Canonical SMILES | N#CCCOP(OC1C(OC(N2C=CC(=O)NC2=O)C1OC(=O)C)COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)N(C(C)C)C(C)C |