Bisphenol F bis(2,3-dihydroxypropyl) ether
Applications: Bisphenol F Bis(2,3-dihydroxypropyl)ether is a derivative of Bisphenol F Diglycidyl Ether. Bisphenol F Bis(2,3-dihydroxypropyl)ether is used as a standard for determining toxic monomers released from polymers of the inner coating of cans.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72406-26-9 |
| Pricing | Inquire |
| Cas | 72406-26-9 |
| Molecular Weight | 348.39 |
| Molecular Formula | C19H24O6 |
| Canonical SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)OCC(CO)O)OCC(CO)O |