Granaticin B
It is produced by the strain of Streptomyces olvaceus var. ETH 7437, Str. violaceoruber. It inhibits the initial stage of RNA biosynthesis, has anti-gram-positive bacteria, Mycobacterium (weak) and vaginal trichomonas activity, but also can inhibit tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01278 |
| Pricing | Inquire |
| Cas | 19879-03-9 |
| Molecular Weight | 558.53 |
| Molecular Formula | C28H30O12 |
| Canonical SMILES | CC1C(CCC(O1)OC2CC3C4=C(C2(C(O3)C)O)C(=C5C(=C4O)C(=O)C6=C(C5=O)C(OC7C6OC(=O)C7)C)O)O |