BISPHENOL F DIGLYCIDYL ETHER
Applications: Bisphenol F Diglycidyl Ether is an novalac glycidyl ether (NOGE). Bisphenol F Diglycidyl Ether is found in resin used as coatings for food cans. Bisphenol F Diglycidyl Ether is a toxic conatminant with strict limitations on the amount allowed in food products.Dangerous Goods Info: Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095-03-6 |
| Pricing | Inquire |
| Cas | 2095-03-6 |
| Molecular Weight | 312.36 |
| Molecular Formula | C19H20O4 |
| Canonical SMILES | C1C(O1)COC2=CC=C(C=C2)CC3=CC=C(C=C3)OCC4CO4 |