7-Fluoro-7-deaza-2'-deoxyadenosine
7-Fluoro-7-deaza-2'-deoxyadenosine, a remarkable compound, holds great significance in the field of biomedicine due to its exceptional antiviral attributes. Profoundly effective against viral infections, particularly hepatitis and HIV, this compound functions by impeding viral RNA synthesis, thereby thwarting virus proliferation and dissemination. Moreover, it possesses an intriguing quality of inducing negligible harm to host cells, rendering it a highly auspicious contender for extensive exploration in the realm of antiviral pharmaceutical advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 652965-07-6 |
| Pricing | Inquire |
| Cas | 652965-07-6 |
| Molecular Weight | 268.24 |
| Molecular Formula | C11H13FN4O3 |
| Canonical SMILES | C1C(C(OC1N2C=C(C3=C(N=CN=C32)N)F)CO)O |