ML 385
ML 385 is a novel and specific inhibitor of nuclear factor erythroid 2-related factor 2 (Nrf2; IC50 = 1.9 µM). ML 385 blocks NRF2 transcriptional activity, and enhances the efficacy of carboplatin as well as other chemotherapeutic drugs in lung cancer cells (NSCLC).
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-007736 |
| Pricing | Inquire |
| Cas | 846557-71-9 |
| Molecular Weight | 511.596 |
| Molecular Formula | C29H25N3O4S |
| Canonical SMILES | CC1=CC=CC=C1C(=O)N2CCC3=C2C=CC(=C3)C4=C(SC(=N4)NC(=O)CC5=CC6=C(C=C5)OCO6)C |