Ac-Arg-OH
Ac-Arg-OH is an N-acetyl-L-amino acid that is L-arginine in which one of the hydrogens attached to the nitrogen is replaced by an acetyl group. It has a role as a human metabolite. It is a conjugate acid of a N(alpha)-acetyl-L-argininate.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007627 |
| Pricing | Inquire |
| Cas | 155-84-0 |
| Molecular Weight | 216.24 |
| Molecular Formula | C8H16N4O3 |
| Canonical SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)O |