Walrycin B
Walrycin B is a novel antibacterial compound specifically targeting the essential WalR response regulator. It is known as an analog of toxoflavin, which has been shown to have a strong MIC for B. subtilis and S. aureus but whose mode of action is not clear. It could also interact with WalR to cause bactericidal effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 878419-78-4 |
| Pricing | Inquire |
| Cas | 878419-78-4 |
| Molecular Weight | 337.26 |
| Molecular Formula | C14H10F3N5O2 |
| Canonical SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)C(F)(F)F)C |