Caffeic Acid-[13C3]
Caffeic Acid-[13C3] is the labelled analogue of Caffeic acid. Caffeic Acid is an orally bioavailable, hydroxycinnamic acid derivative and polyphenol, with potential anti-oxidant, anti-inflammatory, and antineoplastic activities. Upon administration, caffeic acid acts as an antioxidant and prevents oxidative stress, thereby preventing DNA damage induced by free radicals.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011824 |
| Pricing | Inquire |
| Cas | 1185245-82-2 |
| Molecular Weight | 183.14 |
| Molecular Formula | C6[13C]3H8O4 |
| Canonical SMILES | C1=CC(=C(C=C1[13CH]=[13CH][13C](=O)O)O)O |