Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-b-D-glucopyranoside
Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-b-D-glucopyranoside, an intricate chemical entity, is extensively employed in the realm of biomedical research. Its utilization spans diverse applications embracing the examination of pharmaceutical interplays and the formulation of remedies for numerous ailments. The compound possesses distinctive characteristics and exhibits intricate phenomena, thereby enabling comprehensive inquiries into drug metabolism, protein binding, and receptor interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2705-286663 |
| Pricing | Inquire |
| Cas | 187022-49-7 |
| Molecular Weight | 572.84 |
| Molecular Formula | C21H24Cl3NO9S |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)SC2=CC=CC=C2)NC(=O)OCC(Cl)(Cl)Cl)OC(=O)C)OC(=O)C |