Biotin-11-uridine-5'-triphosphate, lithium salt
Biotin-11-uridine-5'-triphosphate, lithium salt is a vital tool in biomedical research used for enzymatic labeling of RNA molecules. This modified nucleotide incorporates biotin and uridine into RNA, enabling its efficient detection and isolation. It enables studies like RNA sequencing, analyzing gene expression, and RNA localization. Additionally, it facilitates investigations of RNA-protein interactions, transcription, and translation processes related to diseases and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121714-70-3 |
| Pricing | Inquire |
| Cas | 121714-70-3 |
| Molecular Weight | 878.67 (free acid) |
| Molecular Formula | C28H45N6O18P3S·xLi |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NCCCCCC(=O)NCC=CC3=CN(C(=O)NC3=O)C4C(C(C(O4)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=O)N2 |