1,2,3,4-Tetra-O-benzoyl-6-O-trityl-b-D-galactopyranose
1,2,3,4-Tetra-O-benzoyl-6-O-trityl-b-D-galactopyranose, a compound renowned for its versatility, finds extensive application in the biomedical industry. With its ability to facilitate the synthesis of carbohydrate-based drugs and pharmaceutical intermediates, this remarkable compound contributes significantly to the advancement of medical science.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100740-75-8 |
| Pricing | Inquire |
| Cas | 100740-75-8 |
| Molecular Weight | 838.89 |
| Molecular Formula | C53H42O10 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OC2C(OC(C(C2OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)COC(C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8 |