2,3,3,4-biphenyl tetracarboxylic dianhydride
2,3,3,4-biphenyl tetracarboxylic dianhydride can inhibit tumor proliferation and thus plays an important role in the research progress of oncology-related pharmacology. The compound's unique properties facilitate targeted therapeutic delivery, thereby enhancing the desired efficiency of drug effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36978-41-3 |
| Pricing | Inquire |
| Cas | 36978-41-3 |
| Molecular Weight | 294.22 |
| Molecular Formula | C16H6O6 |
| Canonical SMILES | C1=CC(=C2C(=C1)C(=O)OC2=O)C3=CC4=C(C=C3)C(=O)OC4=O |