Ethyl 2,4,6-tri-O-benzoyl-b-D-thiogalactopyranoside
Ethyl 2,4,6-tri-O-benzoyl-b-D-thiogalactopyranoside is a synthetic compound functioning as a substrate or inhibitor of specific enzymes involved in carbohydrate metabolism. It contributes to biochemical research on various diseases such as diabetes and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1423018-01-2 |
| Pricing | Inquire |
| Cas | 1423018-01-2 |
| Molecular Weight | 536.59 |
| Molecular Formula | C29H28O8S |
| Canonical SMILES | CCSC1C(C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)O)OC(=O)C4=CC=CC=C4 |